About 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde
4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde (PubChem CID 154667399) has the molecular formula C26H24F2N2O2
and a molecular weight of 434.49 g/mol. Its IUPAC name is 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde |
| PubChem CID | 154667399 |
| Molecular Formula | C26H24F2N2O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde |
| SMILES | CN1CCC(F)(F)CC1.O=Cc1ccc2cc(-c3ccc4c(=O)[nH]ccc4c3)ccc2c1 |
| InChI | InChI=1S/C20H13NO2.C6H11F2N/c22-12-13-1-2-15-10-16(4-3-14(15)9-13)17-5-6-19-18(11-17)7-8-21-20(19)23;1-9-4-2-6(7,8)3-5-9/h1-12H,(H,21,23);2-5H2,1H3 |
| InChIKey | JRLQVQRWHGGAFG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde?
The IUPAC name of 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde (CID 154667399) is 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde.
What is the SMILES notation for 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde?
The canonical SMILES for 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde is CN1CCC(F)(F)CC1.O=Cc1ccc2cc(-c3ccc4c(=O)[nH]ccc4c3)ccc2c1.
What is the InChIKey of 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde?
The InChIKey is JRLQVQRWHGGAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13NO2.C6H11F2N/c22-12-13-1-2-15-10-16(4-3-14(15)9-13)17-5-6-19-18(11-17)7-8-21-20(19)23;1-9-4-2-6(7,8)3-5-9/h1-12H,(H,21,23);2-5H2,1H3.
What are the key properties of 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde?
4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde has a molecular weight of 434.49 g/mol, XLogP of 5.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1-methylpiperidine;6-(1-oxo-2H-isoquinolin-6-yl)naphthalene-2-carbaldehyde is sourced from PubChem (CID 154667399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).