C26H19NO2 — CID 15466853
1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione (PubChem CID 15466853) has the molecular formula C26H19NO2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione.
| Compound Name | 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione |
|---|---|
| PubChem CID | 15466853 |
| Molecular Formula | C26H19NO2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(Cc3ccccc3)[nH]c(Cc3ccccc3)c21 |
| InChI | InChI=1S/C26H19NO2/c28-25-19-13-7-8-14-20(19)26(29)24-22(16-18-11-5-2-6-12-18)27-21(23(24)25)15-17-9-3-1-4-10-17/h1-14,27H,15-16H2 |
| InChIKey | SSULRCIDWLXZFF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|