About 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione
1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione (PubChem CID 15466853) has the molecular formula C26H19NO2
and a molecular weight of 377.44 g/mol. Its IUPAC name is 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione.
Molecular Properties
| Compound Name | 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione |
| PubChem CID | 15466853 |
| Molecular Formula | C26H19NO2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(Cc3ccccc3)[nH]c(Cc3ccccc3)c21 |
| InChI | InChI=1S/C26H19NO2/c28-25-19-13-7-8-14-20(19)26(29)24-22(16-18-11-5-2-6-12-18)27-21(23(24)25)15-17-9-3-1-4-10-17/h1-14,27H,15-16H2 |
| InChIKey | SSULRCIDWLXZFF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione?
The IUPAC name of 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione (CID 15466853) is 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione.
What is the SMILES notation for 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione?
The canonical SMILES for 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione is O=C1c2ccccc2C(=O)c2c(Cc3ccccc3)[nH]c(Cc3ccccc3)c21.
What is the InChIKey of 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione?
The InChIKey is SSULRCIDWLXZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19NO2/c28-25-19-13-7-8-14-20(19)26(29)24-22(16-18-11-5-2-6-12-18)27-21(23(24)25)15-17-9-3-1-4-10-17/h1-14,27H,15-16H2.
What are the key properties of 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione?
1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione has a molecular weight of 377.44 g/mol, XLogP of 4.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibenzyl-2H-benzo[f]isoindole-4,9-dione is sourced from PubChem (CID 15466853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).