About 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane
6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane (PubChem CID 154669815) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane.
Molecular Properties
| Compound Name | 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane |
| PubChem CID | 154669815 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane |
| SMILES | C.C/C(N)=C/C1=NCCN(C)C1=O |
| InChI | InChI=1S/C8H13N3O.CH4/c1-6(9)5-7-8(12)11(2)4-3-10-7;/h5H,3-4,9H2,1-2H3;1H4/b6-5-; |
| InChIKey | ZFGMUSJBXOSUDF-YSMBQZINSA-N |
| XLogP | 0.40 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane?
The IUPAC name of 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane (CID 154669815) is 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane.
What is the SMILES notation for 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane?
The canonical SMILES for 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane is C.C/C(N)=C/C1=NCCN(C)C1=O.
What is the InChIKey of 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane?
The InChIKey is ZFGMUSJBXOSUDF-YSMBQZINSA-N. The full InChI is InChI=1S/C8H13N3O.CH4/c1-6(9)5-7-8(12)11(2)4-3-10-7;/h5H,3-4,9H2,1-2H3;1H4/b6-5-;.
What are the key properties of 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane?
6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane has a molecular weight of 183.25 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-2-aminoprop-1-enyl]-4-methyl-2,3-dihydropyrazin-5-one;methane is sourced from PubChem (CID 154669815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).