About (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid
(7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid (PubChem CID 154669878) has the molecular formula C8H8BFO3
and a molecular weight of 181.96 g/mol. Its IUPAC name is (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid.
Molecular Properties
| Compound Name | (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid |
| PubChem CID | 154669878 |
| Molecular Formula | C8H8BFO3 |
| Molecular Weight | 181.96 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid |
| SMILES | OB(O)c1ccc2c(c1F)OCC2 |
| InChI | InChI=1S/C8H8BFO3/c10-7-6(9(11)12)2-1-5-3-4-13-8(5)7/h1-2,11-12H,3-4H2 |
| InChIKey | ITSNQRMHEBGWKM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.96 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid?
The IUPAC name of (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid (CID 154669878) is (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid.
What is the SMILES notation for (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid?
The canonical SMILES for (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid is OB(O)c1ccc2c(c1F)OCC2.
What is the InChIKey of (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid?
The InChIKey is ITSNQRMHEBGWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BFO3/c10-7-6(9(11)12)2-1-5-3-4-13-8(5)7/h1-2,11-12H,3-4H2.
What are the key properties of (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid?
(7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid has a molecular weight of 181.96 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-2,3-dihydro-1-benzofuran-6-yl)boronic acid is sourced from PubChem (CID 154669878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).