C20H22ClN3O3 — CID 154670120
6-chloro-4-[4-[(dimethylamino)methyl]-2,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one (PubChem CID 154670120) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 6-chloro-4-[4-[(dimethylamino)methyl]-2,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one.
| Compound Name | 6-chloro-4-[4-[(dimethylamino)methyl]-2,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 154670120 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 6-chloro-4-[4-[(dimethylamino)methyl]-2,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnc(Cl)cc23)c(OC)cc1CN(C)C |
| InChI | InChI=1S/C20H22ClN3O3/c1-23(2)10-12-6-18(27-5)14(7-17(12)26-4)16-11-24(3)20(25)15-9-22-19(21)8-13(15)16/h6-9,11H,10H2,1-5H3 |
| InChIKey | FFMASLCYCPEDTN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|