C23H43N3O2 — CID 154670296
3-(4-butan-2-ylpiperazin-1-yl)-1-(3-butyl-2-oxa-8-azaspiro[4.5]decan-8-yl)propan-1-one (PubChem CID 154670296) has the molecular formula C23H43N3O2 and a molecular weight of 393.62 g/mol. Its IUPAC name is 3-(4-butan-2-ylpiperazin-1-yl)-1-(3-butyl-2-oxa-8-azaspiro[4.5]decan-8-yl)propan-1-one.
| Compound Name | 3-(4-butan-2-ylpiperazin-1-yl)-1-(3-butyl-2-oxa-8-azaspiro[4.5]decan-8-yl)propan-1-one |
|---|---|
| PubChem CID | 154670296 |
| Molecular Formula | C23H43N3O2 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | 3-(4-butan-2-ylpiperazin-1-yl)-1-(3-butyl-2-oxa-8-azaspiro[4.5]decan-8-yl)propan-1-one |
| SMILES | CCCCC1CC2(CCN(C(=O)CCN3CCN(C(C)CC)CC3)CC2)CO1 |
| InChI | InChI=1S/C23H43N3O2/c1-4-6-7-21-18-23(19-28-21)9-12-26(13-10-23)22(27)8-11-24-14-16-25(17-15-24)20(3)5-2/h20-21H,4-19H2,1-3H3 |
| InChIKey | JOAPFAQAEXDLPI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |