About ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane
ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane (PubChem CID 154670431) has the molecular formula C14H30F2N2
and a molecular weight of 264.40 g/mol. Its IUPAC name is ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 154670431 |
| Molecular Formula | C14H30F2N2 |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CC.CCN1CCC2(CN(C)C2)C(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2.2C2H6/c1-3-14-5-4-9(6-13(2)7-9)10(11,12)8-14;2*1-2/h3-8H2,1-2H3;2*1-2H3 |
| InChIKey | XJDNBRXVJCSORG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane (CID 154670431) is ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane is CC.CC.CCN1CCC2(CN(C)C2)C(F)(F)C1.
What is the InChIKey of ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is XJDNBRXVJCSORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2.2C2H6/c1-3-14-5-4-9(6-13(2)7-9)10(11,12)8-14;2*1-2/h3-8H2,1-2H3;2*1-2H3.
What are the key properties of ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 264.40 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethyl-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 154670431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).