C29H46N4O3S — CID 154670564
4-(4-ethyl-3,5-dimethoxyphenyl)-2-methyl-6-(methylamino)-2,7-naphthyridin-1-one;3-methyloctane;thiohydroxylamine (PubChem CID 154670564) has the molecular formula C29H46N4O3S and a molecular weight of 530.78 g/mol. Its IUPAC name is 4-(4-ethyl-3,5-dimethoxyphenyl)-2-methyl-6-(methylamino)-2,7-naphthyridin-1-one;3-methyloctane;thiohydroxylamine.
| Compound Name | 4-(4-ethyl-3,5-dimethoxyphenyl)-2-methyl-6-(methylamino)-2,7-naphthyridin-1-one;3-methyloctane;thiohydroxylamine |
|---|---|
| PubChem CID | 154670564 |
| Molecular Formula | C29H46N4O3S |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 4-(4-ethyl-3,5-dimethoxyphenyl)-2-methyl-6-(methylamino)-2,7-naphthyridin-1-one;3-methyloctane;thiohydroxylamine |
| SMILES | CCCCCC(C)CC.CCc1c(OC)cc(-c2cn(C)c(=O)c3cnc(NC)cc23)cc1OC.NS |
| InChI | InChI=1S/C20H23N3O3.C9H20.H3NS/c1-6-13-17(25-4)7-12(8-18(13)26-5)16-11-23(3)20(24)15-10-22-19(21-2)9-14(15)16;1-4-6-7-8-9(3)5-2;1-2/h7-11H,6H2,1-5H3,(H,21,22);9H,4-8H2,1-3H3;2H,1H2 |
| InChIKey | TVRBXOPAVYWMLN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|