C16H34N2O — CID 154670657
N-(2-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)formamide;ethane (PubChem CID 154670657) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is N-(2-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)formamide;ethane.
| Compound Name | N-(2-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)formamide;ethane |
|---|---|
| PubChem CID | 154670657 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | N-(2-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)formamide;ethane |
| SMILES | CC.CC.CCCCN1CC2CC(NC=O)CC2C1 |
| InChI | InChI=1S/C12H22N2O.2C2H6/c1-2-3-4-14-7-10-5-12(13-9-15)6-11(10)8-14;2*1-2/h9-12H,2-8H2,1H3,(H,13,15);2*1-2H3 |
| InChIKey | KCJZPSTWNWKRGS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|