C15H28F2N2O2 — CID 154671310
N-[3,3-difluoro-1-(5-methoxypentyl)piperidin-4-yl]-2-methylpropanamide (PubChem CID 154671310) has the molecular formula C15H28F2N2O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is N-[3,3-difluoro-1-(5-methoxypentyl)piperidin-4-yl]-2-methylpropanamide.
| Compound Name | N-[3,3-difluoro-1-(5-methoxypentyl)piperidin-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 154671310 |
| Molecular Formula | C15H28F2N2O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[3,3-difluoro-1-(5-methoxypentyl)piperidin-4-yl]-2-methylpropanamide |
| SMILES | COCCCCCN1CCC(NC(=O)C(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C15H28F2N2O2/c1-12(2)14(20)18-13-7-9-19(11-15(13,16)17)8-5-4-6-10-21-3/h12-13H,4-11H2,1-3H3,(H,18,20) |
| InChIKey | QZKSUBPFWKNMMR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|