About 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane
5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane (PubChem CID 154672065) has the molecular formula C13H26F2N2
and a molecular weight of 248.36 g/mol. Its IUPAC name is 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane.
Molecular Properties
| Compound Name | 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane |
| PubChem CID | 154672065 |
| Molecular Formula | C13H26F2N2 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane |
| SMILES | CC.CCCN1CCC2(CN(C)C2)C(F)(F)C1 |
| InChI | InChI=1S/C11H20F2N2.C2H6/c1-3-5-15-6-4-10(7-14(2)8-10)11(12,13)9-15;1-2/h3-9H2,1-2H3;1-2H3 |
| InChIKey | LLAVAVJYJQXOPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane?
The IUPAC name of 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane (CID 154672065) is 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane.
What is the SMILES notation for 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane?
The canonical SMILES for 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane is CC.CCCN1CCC2(CN(C)C2)C(F)(F)C1.
What is the InChIKey of 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane?
The InChIKey is LLAVAVJYJQXOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2.C2H6/c1-3-5-15-6-4-10(7-14(2)8-10)11(12,13)9-15;1-2/h3-9H2,1-2H3;1-2H3.
What are the key properties of 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane?
5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane has a molecular weight of 248.36 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-2-methyl-7-propyl-2,7-diazaspiro[3.5]nonane;ethane is sourced from PubChem (CID 154672065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).