C42H47N7O7 — CID 154672130
5-[4-[2-[1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 154672130) has the molecular formula C42H47N7O7 and a molecular weight of 761.88 g/mol. Its IUPAC name is 5-[4-[2-[1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[2-[1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 154672130 |
| Molecular Formula | C42H47N7O7 |
| Molecular Weight | 761.88 g/mol |
| Exact Mass | 761.35 |
| IUPAC Name | 5-[4-[2-[1-[[2,6-dimethoxy-4-(2-methyl-1-oxo-2,7-naphthyridin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1CN1CCC(CCN2CCN(c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C42H47N7O7/c1-45-24-33(29-8-12-43-23-32(29)40(45)52)27-20-36(55-2)34(37(21-27)56-3)25-47-14-10-26(11-15-47)9-13-46-16-18-48(19-17-46)28-4-5-30-31(22-28)42(54)49(41(30)53)35-6-7-38(50)44-39(35)51/h4-5,8,12,20-24,26,35H,6-7,9-11,13-19,25H2,1-3H3,(H,44,50,51) |
| InChIKey | QMJVUIZAJSMYDQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|