About ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane
ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane (PubChem CID 154672526) has the molecular formula C18H35F2N3
and a molecular weight of 331.50 g/mol. Its IUPAC name is ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 154672526 |
| Molecular Formula | C18H35F2N3 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.28 |
| IUPAC Name | ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CCN1CCC(CN2CCC3(CN(C)C3)C(F)(F)C2)CC1 |
| InChI | InChI=1S/C16H29F2N3.C2H6/c1-3-20-7-4-14(5-8-20)10-21-9-6-15(11-19(2)12-15)16(17,18)13-21;1-2/h14H,3-13H2,1-2H3;1-2H3 |
| InChIKey | FYOPEDUWSJQOJD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane (CID 154672526) is ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane is CC.CCN1CCC(CN2CCC3(CN(C)C3)C(F)(F)C2)CC1.
What is the InChIKey of ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is FYOPEDUWSJQOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29F2N3.C2H6/c1-3-20-7-4-14(5-8-20)10-21-9-6-15(11-19(2)12-15)16(17,18)13-21;1-2/h14H,3-13H2,1-2H3;1-2H3.
What are the key properties of ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane?
ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 331.50 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-[(1-ethylpiperidin-4-yl)methyl]-5,5-difluoro-2-methyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 154672526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).