C17H18N2O2 — CID 154672591
4-[(3E,5Z)-5-methoxyhepta-1,3,5-trien-3-yl]-2-methyl-2,7-naphthyridin-1-one (PubChem CID 154672591) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[(3E,5Z)-5-methoxyhepta-1,3,5-trien-3-yl]-2-methyl-2,7-naphthyridin-1-one.
| Compound Name | 4-[(3E,5Z)-5-methoxyhepta-1,3,5-trien-3-yl]-2-methyl-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 154672591 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[(3E,5Z)-5-methoxyhepta-1,3,5-trien-3-yl]-2-methyl-2,7-naphthyridin-1-one |
| SMILES | C=C/C(=C\C(=C\C)OC)c1cn(C)c(=O)c2cnccc12 |
| InChI | InChI=1S/C17H18N2O2/c1-5-12(9-13(6-2)21-4)16-11-19(3)17(20)15-10-18-8-7-14(15)16/h5-11H,1H2,2-4H3/b12-9+,13-6- |
| InChIKey | TYCPKIBFPUAFMB-LREUKMEISA-N |
| XLogP | 3.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|