C15H20 — CID 154673136
2-methyl-1,2,3,4,4a,9,9a,10-octahydroanthracene (PubChem CID 154673136) has the molecular formula C15H20 and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,4a,9,9a,10-octahydroanthracene.
| Compound Name | 2-methyl-1,2,3,4,4a,9,9a,10-octahydroanthracene |
|---|---|
| PubChem CID | 154673136 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-methyl-1,2,3,4,4a,9,9a,10-octahydroanthracene |
| SMILES | CC1CCC2Cc3ccccc3CC2C1 |
| InChI | InChI=1S/C15H20/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11/h2-5,11,14-15H,6-10H2,1H3 |
| InChIKey | PSFLLJNCDVLVGL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |