C18H27N3O3 — CID 154673240
[1-(5-formyl-3-methyl-2-pyridinyl)piperidin-4-yl]methyl N-tert-butylcarbamate (PubChem CID 154673240) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is [1-(5-formyl-3-methyl-2-pyridinyl)piperidin-4-yl]methyl N-tert-butylcarbamate.
| Compound Name | [1-(5-formyl-3-methyl-2-pyridinyl)piperidin-4-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 154673240 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [1-(5-formyl-3-methyl-2-pyridinyl)piperidin-4-yl]methyl N-tert-butylcarbamate |
| SMILES | Cc1cc(C=O)cnc1N1CCC(COC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H27N3O3/c1-13-9-15(11-22)10-19-16(13)21-7-5-14(6-8-21)12-24-17(23)20-18(2,3)4/h9-11,14H,5-8,12H2,1-4H3,(H,20,23) |
| InChIKey | TVJUCGKHXSATIU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|