C13H19N3 — CID 154673291
ethane;3,7,7-trimethylcyclohepta[e][1,2,4]triazine (PubChem CID 154673291) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is ethane;3,7,7-trimethylcyclohepta[e][1,2,4]triazine.
| Compound Name | ethane;3,7,7-trimethylcyclohepta[e][1,2,4]triazine |
|---|---|
| PubChem CID | 154673291 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | ethane;3,7,7-trimethylcyclohepta[e][1,2,4]triazine |
| SMILES | CC.Cc1nnc2c(n1)C=CC(C)(C)C=C2 |
| InChI | InChI=1S/C11H13N3.C2H6/c1-8-12-9-4-6-11(2,3)7-5-10(9)14-13-8;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | BHMFRAPKBGRHBQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |