C13H13N6O2+ — CID 154673320
3-[4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 154673320) has the molecular formula C13H13N6O2+ and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-[4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 154673320 |
| Molecular Formula | C13H13N6O2+ |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | Cc1nnc2c(-c3cc[n+](CCC(=O)O)nc3)nccn12 |
| InChI | InChI=1S/C13H12N6O2/c1-9-16-17-13-12(14-4-7-19(9)13)10-2-5-18(15-8-10)6-3-11(20)21/h2,4-5,7-8H,3,6H2,1H3/p+1 |
| InChIKey | WEAFQRRUHLZHGS-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 97.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|