C15H25FN2O2 — CID 154673401
ethane;(3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 154673401) has the molecular formula C15H25FN2O2 and a molecular weight of 284.38 g/mol. Its IUPAC name is ethane;(3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | ethane;(3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154673401 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | ethane;(3S,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | C=C(/C=C(\C)C(C)(C)F)[C@H]1CNC(=O)[C@@H]1C(N)=O.CC |
| InChI | InChI=1S/C13H19FN2O2.C2H6/c1-7(5-8(2)13(3,4)14)9-6-16-12(18)10(9)11(15)17;1-2/h5,9-10H,1,6H2,2-4H3,(H2,15,17)(H,16,18);1-2H3/b8-5+;/t9-,10+;/m1./s1 |
| InChIKey | MIKYPZJJPIFEED-IXGCEUQMSA-N |
| XLogP | 2.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|