About methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate
methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate (PubChem CID 154673508) has the molecular formula C12H13N4O2+
and a molecular weight of 245.26 g/mol. Its IUPAC name is methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate |
| PubChem CID | 154673508 |
| Molecular Formula | C12H13N4O2+ |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate |
| SMILES | COC(=O)C[n+]1ccc(-c2cnnc(C)n2)cc1 |
| InChI | InChI=1S/C12H13N4O2/c1-9-14-11(7-13-15-9)10-3-5-16(6-4-10)8-12(17)18-2/h3-7H,8H2,1-2H3/q+1 |
| InChIKey | PNYIDXRKGGGIKJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate?
The IUPAC name of methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate (CID 154673508) is methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate.
What is the SMILES notation for methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate?
The canonical SMILES for methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate is COC(=O)C[n+]1ccc(-c2cnnc(C)n2)cc1.
What is the InChIKey of methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate?
The InChIKey is PNYIDXRKGGGIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N4O2/c1-9-14-11(7-13-15-9)10-3-5-16(6-4-10)8-12(17)18-2/h3-7H,8H2,1-2H3/q+1.
What are the key properties of methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate?
methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate has a molecular weight of 245.26 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(3-methyl-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetate is sourced from PubChem (CID 154673508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).