About 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid
2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid (PubChem CID 154673538) has the molecular formula C10H10N5O2+
and a molecular weight of 232.22 g/mol. Its IUPAC name is 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid |
| PubChem CID | 154673538 |
| Molecular Formula | C10H10N5O2+ |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid |
| SMILES | Nc1nncc(-c2cc[n+](CC(=O)O)cc2)n1 |
| InChI | InChI=1S/C10H9N5O2/c11-10-13-8(5-12-14-10)7-1-3-15(4-2-7)6-9(16)17/h1-5H,6H2,(H2-,11,13,14,16,17)/p+1 |
| InChIKey | UXJGXAKZJMZDDR-UHFFFAOYSA-O |
| XLogP | -0.51 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid?
The IUPAC name of 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid (CID 154673538) is 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid?
The canonical SMILES for 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid is Nc1nncc(-c2cc[n+](CC(=O)O)cc2)n1.
What is the InChIKey of 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid?
The InChIKey is UXJGXAKZJMZDDR-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H9N5O2/c11-10-13-8(5-12-14-10)7-1-3-15(4-2-7)6-9(16)17/h1-5H,6H2,(H2-,11,13,14,16,17)/p+1.
What are the key properties of 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid?
2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid has a molecular weight of 232.22 g/mol, XLogP of -0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-amino-1,2,4-triazin-5-yl)pyridin-1-ium-1-yl]acetic acid is sourced from PubChem (CID 154673538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).