About 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate
2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate (PubChem CID 154673617) has the molecular formula C13H10F3N3O4
and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate |
| PubChem CID | 154673617 |
| Molecular Formula | C13H10F3N3O4 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)C[n+]1ccc(-c2ccnnc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H9N3O2.C2HF3O2/c15-11(16)8-14-5-2-9(3-6-14)10-1-4-12-13-7-10;3-2(4,5)1(6)7/h1-7H,8H2;(H,6,7) |
| InChIKey | FRJHRWRZFQAFPO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate?
The IUPAC name of 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate (CID 154673617) is 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate.
What is the SMILES notation for 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate?
The canonical SMILES for 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate is O=C(O)C[n+]1ccc(-c2ccnnc2)cc1.O=C([O-])C(F)(F)F.
What is the InChIKey of 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate?
The InChIKey is FRJHRWRZFQAFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2.C2HF3O2/c15-11(16)8-14-5-2-9(3-6-14)10-1-4-12-13-7-10;3-2(4,5)1(6)7/h1-7H,8H2;(H,6,7).
What are the key properties of 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate?
2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate has a molecular weight of 329.23 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-pyridazin-4-ylpyridin-1-ium-1-yl)acetic acid;2,2,2-trifluoroacetate is sourced from PubChem (CID 154673617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).