About 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid
3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid (PubChem CID 154673670) has the molecular formula C10H10N3O2S+
and a molecular weight of 236.28 g/mol. Its IUPAC name is 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid |
| PubChem CID | 154673670 |
| Molecular Formula | C10H10N3O2S+ |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2ncns2)cc1 |
| InChI | InChI=1S/C10H9N3O2S/c14-9(15)3-6-13-4-1-8(2-5-13)10-11-7-12-16-10/h1-2,4-5,7H,3,6H2/p+1 |
| InChIKey | SLCKAMIMHGDCLS-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid?
The IUPAC name of 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid (CID 154673670) is 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid?
The canonical SMILES for 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid is O=C(O)CC[n+]1ccc(-c2ncns2)cc1.
What is the InChIKey of 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid?
The InChIKey is SLCKAMIMHGDCLS-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H9N3O2S/c14-9(15)3-6-13-4-1-8(2-5-13)10-11-7-12-16-10/h1-2,4-5,7H,3,6H2/p+1.
What are the key properties of 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid?
3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid has a molecular weight of 236.28 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid is sourced from PubChem (CID 154673670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).