C11H11F3N3O3S2+ — CID 154673671
methyl 2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]ethanesulfonate (PubChem CID 154673671) has the molecular formula C11H11F3N3O3S2+ and a molecular weight of 354.36 g/mol. Its IUPAC name is methyl 2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]ethanesulfonate.
| Compound Name | methyl 2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 154673671 |
| Molecular Formula | C11H11F3N3O3S2+ |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | methyl 2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]ethanesulfonate |
| SMILES | COS(=O)(=O)CC[n+]1ccc(-c2nc(C(F)(F)F)ns2)cc1 |
| InChI | InChI=1S/C11H11F3N3O3S2/c1-20-22(18,19)7-6-17-4-2-8(3-5-17)9-15-10(16-21-9)11(12,13)14/h2-5H,6-7H2,1H3/q+1 |
| InChIKey | LLCYTQXXVDSYDI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|