C13H12F3N3O4S — CID 154673718
methyl 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoate;2,2,2-trifluoroacetate (PubChem CID 154673718) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is methyl 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoate;2,2,2-trifluoroacetate.
| Compound Name | methyl 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154673718 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | methyl 3-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoate;2,2,2-trifluoroacetate |
| SMILES | COC(=O)CC[n+]1ccc(-c2ncns2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H12N3O2S.C2HF3O2/c1-16-10(15)4-7-14-5-2-9(3-6-14)11-12-8-13-17-11;3-2(4,5)1(6)7/h2-3,5-6,8H,4,7H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | NXVLWVZJWBUIEP-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 96.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|