About [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid
[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid (PubChem CID 154673730) has the molecular formula C8H8N3O3S2+
and a molecular weight of 258.30 g/mol. Its IUPAC name is [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid.
Molecular Properties
| Compound Name | [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid |
| PubChem CID | 154673730 |
| Molecular Formula | C8H8N3O3S2+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)C[n+]1ccc(-c2ncns2)cc1 |
| InChI | InChI=1S/C8H7N3O3S2/c12-16(13,14)6-11-3-1-7(2-4-11)8-9-5-10-15-8/h1-5H,6H2/p+1 |
| InChIKey | VJKBRBVDFRGUQF-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid?
The IUPAC name of [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid (CID 154673730) is [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid.
What is the SMILES notation for [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid?
The canonical SMILES for [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid is O=S(=O)(O)C[n+]1ccc(-c2ncns2)cc1.
What is the InChIKey of [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid?
The InChIKey is VJKBRBVDFRGUQF-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H7N3O3S2/c12-16(13,14)6-11-3-1-7(2-4-11)8-9-5-10-15-8/h1-5H,6H2/p+1.
What are the key properties of [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid?
[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid has a molecular weight of 258.30 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]methanesulfonic acid is sourced from PubChem (CID 154673730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).