About methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid
methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid (PubChem CID 154673785) has the molecular formula C14H15F3N3O4S+
and a molecular weight of 378.35 g/mol. Its IUPAC name is methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid.
Molecular Properties
| Compound Name | methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid |
| PubChem CID | 154673785 |
| Molecular Formula | C14H15F3N3O4S+ |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid |
| SMILES | COC(C)=O.O=C(O)CC[n+]1ccc(-c2nc(C(F)(F)F)ns2)cc1 |
| InChI | InChI=1S/C11H8F3N3O2S.C3H6O2/c12-11(13,14)10-15-9(20-16-10)7-1-4-17(5-2-7)6-3-8(18)19;1-3(4)5-2/h1-2,4-5H,3,6H2;1-2H3/p+1 |
| InChIKey | YHMFMIQWNAONMP-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid?
The IUPAC name of methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid (CID 154673785) is methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid.
What is the SMILES notation for methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid?
The canonical SMILES for methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid is COC(C)=O.O=C(O)CC[n+]1ccc(-c2nc(C(F)(F)F)ns2)cc1.
What is the InChIKey of methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid?
The InChIKey is YHMFMIQWNAONMP-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H8F3N3O2S.C3H6O2/c12-11(13,14)10-15-9(20-16-10)7-1-4-17(5-2-7)6-3-8(18)19;1-3(4)5-2/h1-2,4-5H,3,6H2;1-2H3/p+1.
What are the key properties of methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid?
methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid has a molecular weight of 378.35 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid is sourced from PubChem (CID 154673785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).