C14H12F6N3O3S+ — CID 154673800
3,3,3-trifluoro-2-methoxyprop-1-ene;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid (PubChem CID 154673800) has the molecular formula C14H12F6N3O3S+ and a molecular weight of 416.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methoxyprop-1-ene;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid.
| Compound Name | 3,3,3-trifluoro-2-methoxyprop-1-ene;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 154673800 |
| Molecular Formula | C14H12F6N3O3S+ |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 3,3,3-trifluoro-2-methoxyprop-1-ene;2-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]acetic acid |
| SMILES | C=C(OC)C(F)(F)F.O=C(O)C[n+]1ccc(-c2nc(C(F)(F)F)ns2)cc1 |
| InChI | InChI=1S/C10H6F3N3O2S.C4H5F3O/c11-10(12,13)9-14-8(19-15-9)6-1-3-16(4-2-6)5-7(17)18;1-3(8-2)4(5,6)7/h1-4H,5H2;1H2,2H3/p+1 |
| InChIKey | WBWMJEQGUZRBSL-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|