C13H12F3N3O4S — CID 154673824
3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid acetate (PubChem CID 154673824) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is 3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid acetate.
| Compound Name | 3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid acetate |
|---|---|
| PubChem CID | 154673824 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid acetate |
| SMILES | CC(=O)[O-].O=C(O)CC[n+]1ccc(-c2nc(C(F)(F)F)ns2)cc1 |
| InChI | InChI=1S/C11H8F3N3O2S.C2H4O2/c12-11(13,14)10-15-9(20-16-10)7-1-4-17(5-2-7)6-3-8(18)19;1-2(3)4/h1-2,4-5H,3,6H2;1H3,(H,3,4) |
| InChIKey | ODZYSZDVDLVNMK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|