About 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile
1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile (PubChem CID 154673893) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile |
| PubChem CID | 154673893 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile |
| SMILES | Cn1ncc2cc(C#N)nnc21 |
| InChI | InChI=1S/C7H5N5/c1-12-7-5(4-9-12)2-6(3-8)10-11-7/h2,4H,1H3 |
| InChIKey | HBQNEODBRUCGHP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile?
The IUPAC name of 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile (CID 154673893) is 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile.
What is the SMILES notation for 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile?
The canonical SMILES for 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile is Cn1ncc2cc(C#N)nnc21.
What is the InChIKey of 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile?
The InChIKey is HBQNEODBRUCGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c1-12-7-5(4-9-12)2-6(3-8)10-11-7/h2,4H,1H3.
What are the key properties of 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile?
1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazolo[3,4-c]pyridazine-5-carbonitrile is sourced from PubChem (CID 154673893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).