About 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine
1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine (PubChem CID 154673911) has the molecular formula C14H14N4O2S
and a molecular weight of 302.36 g/mol. Its IUPAC name is 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine.
Molecular Properties
| Compound Name | 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine |
| PubChem CID | 154673911 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nnc3c2cnn3C)cc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-9-4-6-11(7-5-9)21(19,20)13-10(2)16-17-14-12(13)8-15-18(14)3/h4-8H,1-3H3 |
| InChIKey | SWUKMZRNJQGBGQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine?
The IUPAC name of 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine (CID 154673911) is 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine.
What is the SMILES notation for 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine?
The canonical SMILES for 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine is Cc1ccc(S(=O)(=O)c2c(C)nnc3c2cnn3C)cc1.
What is the InChIKey of 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine?
The InChIKey is SWUKMZRNJQGBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2S/c1-9-4-6-11(7-5-9)21(19,20)13-10(2)16-17-14-12(13)8-15-18(14)3/h4-8H,1-3H3.
What are the key properties of 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine?
1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine has a molecular weight of 302.36 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine is sourced from PubChem (CID 154673911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).