C15H17N4O2S+ — CID 154673917
1,5,6-trimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazin-6-ium (PubChem CID 154673917) has the molecular formula C15H17N4O2S+ and a molecular weight of 317.39 g/mol. Its IUPAC name is 1,5,6-trimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazin-6-ium.
| Compound Name | 1,5,6-trimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazin-6-ium |
|---|---|
| PubChem CID | 154673917 |
| Molecular Formula | C15H17N4O2S+ |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1,5,6-trimethyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazin-6-ium |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)[n+](C)nc3c2cnn3C)cc1 |
| InChI | InChI=1S/C15H17N4O2S/c1-10-5-7-12(8-6-10)22(20,21)14-11(2)18(3)17-15-13(14)9-16-19(15)4/h5-9H,1-4H3/q+1 |
| InChIKey | NFZUSPYOZFTWMZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|