About 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine
3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine (PubChem CID 154673939) has the molecular formula C23H30FNOS
and a molecular weight of 387.56 g/mol. Its IUPAC name is 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine.
Molecular Properties
| Compound Name | 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine |
| PubChem CID | 154673939 |
| Molecular Formula | C23H30FNOS |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine |
| SMILES | CCCCC1(CC)CSc2cc(OC)c(C)cc2N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H30FNOS/c1-5-7-12-23(6-2)15-25(19-10-8-18(24)9-11-19)20-13-17(3)21(26-4)14-22(20)27-16-23/h8-11,13-14H,5-7,12,15-16H2,1-4H3 |
| InChIKey | QWCKIDRPPPFANS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine?
The IUPAC name of 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine (CID 154673939) is 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine.
What is the SMILES notation for 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine?
The canonical SMILES for 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine is CCCCC1(CC)CSc2cc(OC)c(C)cc2N(c2ccc(F)cc2)C1.
What is the InChIKey of 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine?
The InChIKey is QWCKIDRPPPFANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30FNOS/c1-5-7-12-23(6-2)15-25(19-10-8-18(24)9-11-19)20-13-17(3)21(26-4)14-22(20)27-16-23/h8-11,13-14H,5-7,12,15-16H2,1-4H3.
What are the key properties of 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine?
3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine has a molecular weight of 387.56 g/mol, XLogP of 6.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-ethyl-5-(4-fluorophenyl)-8-methoxy-7-methyl-2,4-dihydro-1,5-benzothiazepine is sourced from PubChem (CID 154673939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).