C12H17F3N3O5S+ — CID 154674108
1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene (PubChem CID 154674108) has the molecular formula C12H17F3N3O5S+ and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene.
| Compound Name | 1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 154674108 |
| Molecular Formula | C12H17F3N3O5S+ |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
| SMILES | C=C(OC)C(F)(F)F.CNS(=O)(=O)CC[n+]1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C8H11N3O4S.C4H5F3O/c1-9-16(14,15)5-4-11-3-2-7(6-10-11)8(12)13;1-3(8-2)4(5,6)7/h2-3,6,9H,4-5H2,1H3;1H2,2H3/p+1 |
| InChIKey | ITDNFTMKMPOJQB-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|