C12H16F3N2O5+ — CID 154674143
1-(3-carboxypropyl)pyridazin-1-ium-4-carboxylic acid;1,1,1-trifluoro-2-methoxyethane (PubChem CID 154674143) has the molecular formula C12H16F3N2O5+ and a molecular weight of 325.26 g/mol. Its IUPAC name is 1-(3-carboxypropyl)pyridazin-1-ium-4-carboxylic acid;1,1,1-trifluoro-2-methoxyethane.
| Compound Name | 1-(3-carboxypropyl)pyridazin-1-ium-4-carboxylic acid;1,1,1-trifluoro-2-methoxyethane |
|---|---|
| PubChem CID | 154674143 |
| Molecular Formula | C12H16F3N2O5+ |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(3-carboxypropyl)pyridazin-1-ium-4-carboxylic acid;1,1,1-trifluoro-2-methoxyethane |
| SMILES | COCC(F)(F)F.O=C(O)CCC[n+]1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C9H10N2O4.C3H5F3O/c12-8(13)2-1-4-11-5-3-7(6-10-11)9(14)15;1-7-2-3(4,5)6/h3,5-6H,1-2,4H2,(H-,12,13,14,15);2H2,1H3/p+1 |
| InChIKey | QSXDKZXIVKKEOV-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|