C11H12F3N3O7S — CID 154674169
methyl 1-[2-(methanesulfonamido)-2-oxoethyl]pyridazin-1-ium-4-carboxylate;2,2,2-trifluoroacetate (PubChem CID 154674169) has the molecular formula C11H12F3N3O7S and a molecular weight of 387.29 g/mol. Its IUPAC name is methyl 1-[2-(methanesulfonamido)-2-oxoethyl]pyridazin-1-ium-4-carboxylate;2,2,2-trifluoroacetate.
| Compound Name | methyl 1-[2-(methanesulfonamido)-2-oxoethyl]pyridazin-1-ium-4-carboxylate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154674169 |
| Molecular Formula | C11H12F3N3O7S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | methyl 1-[2-(methanesulfonamido)-2-oxoethyl]pyridazin-1-ium-4-carboxylate;2,2,2-trifluoroacetate |
| SMILES | COC(=O)c1cc[n+](CC(=O)NS(C)(=O)=O)nc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H11N3O5S.C2HF3O2/c1-17-9(14)7-3-4-12(10-5-7)6-8(13)11-18(2,15)16;3-2(4,5)1(6)7/h3-5H,6H2,1-2H3;(H,6,7) |
| InChIKey | FRHBIHARSFWSTF-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|