C13H17F3N3O4+ — CID 154674183
1-[3-(methylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene (PubChem CID 154674183) has the molecular formula C13H17F3N3O4+ and a molecular weight of 336.29 g/mol. Its IUPAC name is 1-[3-(methylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene.
| Compound Name | 1-[3-(methylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 154674183 |
| Molecular Formula | C13H17F3N3O4+ |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-[3-(methylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
| SMILES | C=C(OC)C(F)(F)F.CNC(=O)CC[n+]1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C9H11N3O3.C4H5F3O/c1-10-8(13)3-5-12-4-2-7(6-11-12)9(14)15;1-3(8-2)4(5,6)7/h2,4,6H,3,5H2,1H3,(H-,10,13,14,15);1H2,2H3/p+1 |
| InChIKey | RPWDARNGSMTDEH-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|