C14H19F3N3O4+ — CID 154674187
1-[3-(dimethylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene (PubChem CID 154674187) has the molecular formula C14H19F3N3O4+ and a molecular weight of 350.32 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene.
| Compound Name | 1-[3-(dimethylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 154674187 |
| Molecular Formula | C14H19F3N3O4+ |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[3-(dimethylamino)-3-oxopropyl]pyridazin-1-ium-4-carboxylic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
| SMILES | C=C(OC)C(F)(F)F.CN(C)C(=O)CC[n+]1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C10H13N3O3.C4H5F3O/c1-12(2)9(14)4-6-13-5-3-8(7-11-13)10(15)16;1-3(8-2)4(5,6)7/h3,5,7H,4,6H2,1-2H3;1H2,2H3/p+1 |
| InChIKey | AOMKBUKDCQTOGI-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|