C10H12F3N3O6S — CID 154674204
1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;2,2,2-trifluoroacetate (PubChem CID 154674204) has the molecular formula C10H12F3N3O6S and a molecular weight of 359.28 g/mol. Its IUPAC name is 1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;2,2,2-trifluoroacetate.
| Compound Name | 1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154674204 |
| Molecular Formula | C10H12F3N3O6S |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 1-[2-(methylsulfamoyl)ethyl]pyridazin-1-ium-4-carboxylic acid;2,2,2-trifluoroacetate |
| SMILES | CNS(=O)(=O)CC[n+]1ccc(C(=O)O)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H11N3O4S.C2HF3O2/c1-9-16(14,15)5-4-11-3-2-7(6-10-11)8(12)13;3-2(4,5)1(6)7/h2-3,6,9H,4-5H2,1H3;(H,6,7) |
| InChIKey | FSPXNVAXWKLPCA-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 140.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|