About 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane
1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane (PubChem CID 154674209) has the molecular formula C10H14F3N2O4S+
and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane |
| PubChem CID | 154674209 |
| Molecular Formula | C10H14F3N2O4S+ |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane |
| SMILES | COCC[n+]1ccc(C(=O)O)cn1.COSC(F)(F)F |
| InChI | InChI=1S/C8H10N2O3.C2H3F3OS/c1-13-5-4-10-3-2-7(6-9-10)8(11)12;1-6-7-2(3,4)5/h2-3,6H,4-5H2,1H3;1H3/p+1 |
| InChIKey | RMAGGONXQKZGNM-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane?
The IUPAC name of 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane (CID 154674209) is 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane.
What is the SMILES notation for 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane?
The canonical SMILES for 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane is COCC[n+]1ccc(C(=O)O)cn1.COSC(F)(F)F.
What is the InChIKey of 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane?
The InChIKey is RMAGGONXQKZGNM-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H10N2O3.C2H3F3OS/c1-13-5-4-10-3-2-7(6-9-10)8(11)12;1-6-7-2(3,4)5/h2-3,6H,4-5H2,1H3;1H3/p+1.
What are the key properties of 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane?
1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane has a molecular weight of 315.29 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylic acid;trifluoro(methoxysulfanyl)methane is sourced from PubChem (CID 154674209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).