C22H25N5OS — CID 154674292
8-[(2-amino-4-pyridinyl)methylamino]-N-(2-methylphenyl)-6-oxo-5-azaspiro[3.5]non-7-ene-7-carbothioamide (PubChem CID 154674292) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 8-[(2-amino-4-pyridinyl)methylamino]-N-(2-methylphenyl)-6-oxo-5-azaspiro[3.5]non-7-ene-7-carbothioamide.
| Compound Name | 8-[(2-amino-4-pyridinyl)methylamino]-N-(2-methylphenyl)-6-oxo-5-azaspiro[3.5]non-7-ene-7-carbothioamide |
|---|---|
| PubChem CID | 154674292 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 8-[(2-amino-4-pyridinyl)methylamino]-N-(2-methylphenyl)-6-oxo-5-azaspiro[3.5]non-7-ene-7-carbothioamide |
| SMILES | Cc1ccccc1NC(=S)C1=C(NCc2ccnc(N)c2)CC2(CCC2)NC1=O |
| InChI | InChI=1S/C22H25N5OS/c1-14-5-2-3-6-16(14)26-21(29)19-17(12-22(8-4-9-22)27-20(19)28)25-13-15-7-10-24-18(23)11-15/h2-3,5-7,10-11,25H,4,8-9,12-13H2,1H3,(H2,23,24)(H,26,29)(H,27,28) |
| InChIKey | USIJXVGAMVSEHK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|