About 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one
5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one (PubChem CID 154674590) has the molecular formula C8H10O6S3
and a molecular weight of 298.36 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one.
Molecular Properties
| Compound Name | 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one |
| PubChem CID | 154674590 |
| Molecular Formula | C8H10O6S3 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one |
| SMILES | O=C1OC(COSOCC2CSC(=O)O2)CS1 |
| InChI | InChI=1S/C8H10O6S3/c9-7-13-5(3-15-7)1-11-17-12-2-6-4-16-8(10)14-6/h5-6H,1-4H2 |
| InChIKey | FCAGJIOPAAXUDX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one?
The IUPAC name of 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one (CID 154674590) is 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one.
What is the SMILES notation for 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one?
The canonical SMILES for 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one is O=C1OC(COSOCC2CSC(=O)O2)CS1.
What is the InChIKey of 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one?
The InChIKey is FCAGJIOPAAXUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O6S3/c9-7-13-5(3-15-7)1-11-17-12-2-6-4-16-8(10)14-6/h5-6H,1-4H2.
What are the key properties of 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one?
5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one has a molecular weight of 298.36 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-1,3-oxathiolan-5-yl)methoxysulfanyloxymethyl]-1,3-oxathiolan-2-one is sourced from PubChem (CID 154674590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).