About 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one
5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one (PubChem CID 154674592) has the molecular formula C12H18O6S2
and a molecular weight of 322.40 g/mol. Its IUPAC name is 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one.
Molecular Properties
| Compound Name | 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one |
| PubChem CID | 154674592 |
| Molecular Formula | C12H18O6S2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one |
| SMILES | O=C1OC(COCCCCOCC2CSC(=O)O2)CS1 |
| InChI | InChI=1S/C12H18O6S2/c13-11-17-9(7-19-11)5-15-3-1-2-4-16-6-10-8-20-12(14)18-10/h9-10H,1-8H2 |
| InChIKey | YIAQDJYWZJEADI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one?
The IUPAC name of 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one (CID 154674592) is 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one.
What is the SMILES notation for 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one?
The canonical SMILES for 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one is O=C1OC(COCCCCOCC2CSC(=O)O2)CS1.
What is the InChIKey of 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one?
The InChIKey is YIAQDJYWZJEADI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O6S2/c13-11-17-9(7-19-11)5-15-3-1-2-4-16-6-10-8-20-12(14)18-10/h9-10H,1-8H2.
What are the key properties of 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one?
5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one has a molecular weight of 322.40 g/mol, XLogP of 2.30, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(2-oxo-1,3-oxathiolan-5-yl)methoxy]butoxymethyl]-1,3-oxathiolan-2-one is sourced from PubChem (CID 154674592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).