C12H13N3O3 — CID 15467469
13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione (PubChem CID 15467469) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione.
| Compound Name | 13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione |
|---|---|
| PubChem CID | 15467469 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione |
| SMILES | CC1(C)Cc2nc3[nH]c(=O)[nH]c(=O)c3cc2CO1 |
| InChI | InChI=1S/C12H13N3O3/c1-12(2)4-8-6(5-18-12)3-7-9(13-8)14-11(17)15-10(7)16/h3H,4-5H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | BQOZEHMEZOMSRI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |