C19H16F4N4O2S — CID 154674698
6-fluoro-N-[6-(4-propan-2-yl-3-pyridinyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 154674698) has the molecular formula C19H16F4N4O2S and a molecular weight of 440.42 g/mol. Its IUPAC name is 6-fluoro-N-[6-(4-propan-2-yl-3-pyridinyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide.
| Compound Name | 6-fluoro-N-[6-(4-propan-2-yl-3-pyridinyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 154674698 |
| Molecular Formula | C19H16F4N4O2S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 6-fluoro-N-[6-(4-propan-2-yl-3-pyridinyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | CC(C)c1ccncc1-c1nc(NS(=O)(=O)c2cccc(F)n2)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H16F4N4O2S/c1-11(2)12-8-9-24-10-13(12)18-14(19(21,22)23)6-7-16(26-18)27-30(28,29)17-5-3-4-15(20)25-17/h3-11H,1-2H3,(H,26,27) |
| InChIKey | MHAWXXCSZBPSOB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|