About 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid
3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid (PubChem CID 154674772) has the molecular formula C22H23ClN4O4S
and a molecular weight of 474.97 g/mol. Its IUPAC name is 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid |
| PubChem CID | 154674772 |
| Molecular Formula | C22H23ClN4O4S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid |
| SMILES | Cc1cccc(C)c1-c1nc(NS(=O)(=O)c2ccnc(NC(C)CC(=O)O)c2)ccc1Cl |
| InChI | InChI=1S/C22H23ClN4O4S/c1-13-5-4-6-14(2)21(13)22-17(23)7-8-18(26-22)27-32(30,31)16-9-10-24-19(12-16)25-15(3)11-20(28)29/h4-10,12,15H,11H2,1-3H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | XRVBAIXODRVCCF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid?
The IUPAC name of 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid (CID 154674772) is 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid.
What is the SMILES notation for 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid?
The canonical SMILES for 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid is Cc1cccc(C)c1-c1nc(NS(=O)(=O)c2ccnc(NC(C)CC(=O)O)c2)ccc1Cl.
What is the InChIKey of 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid?
The InChIKey is XRVBAIXODRVCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClN4O4S/c1-13-5-4-6-14(2)21(13)22-17(23)7-8-18(26-22)27-32(30,31)16-9-10-24-19(12-16)25-15(3)11-20(28)29/h4-10,12,15H,11H2,1-3H3,(H,24,25)(H,26,27)(H,28,29).
What are the key properties of 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid?
3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid has a molecular weight of 474.97 g/mol, XLogP of 4.49, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[[5-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]sulfamoyl]-2-pyridinyl]amino]butanoic acid is sourced from PubChem (CID 154674772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).