C15H30BN3O5 — CID 154674915
(2R,4S)-4-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid (PubChem CID 154674915) has the molecular formula C15H30BN3O5 and a molecular weight of 343.23 g/mol. Its IUPAC name is (2R,4S)-4-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 154674915 |
| Molecular Formula | C15H30BN3O5 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (2R,4S)-4-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@H]1CCN[C@@](CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C15H30BN3O5/c1-10(2)12(17)13(20)19-11-5-8-18-15(9-11,14(21)22)6-3-4-7-16(23)24/h10-12,18,23-24H,3-9,17H2,1-2H3,(H,19,20)(H,21,22)/t11-,12-,15+/m0/s1 |
| InChIKey | LYMTVASYYCLIRY-SLEUVZQESA-N |
| XLogP | -0.70 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|