C18H22ClN3O3 — CID 154675900
tert-butyl (2S,4R)-4-[(7-chloro-1,8-naphthyridin-2-yl)oxy]-2-methylpyrrolidine-1-carboxylate (PubChem CID 154675900) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[(7-chloro-1,8-naphthyridin-2-yl)oxy]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[(7-chloro-1,8-naphthyridin-2-yl)oxy]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154675900 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | tert-butyl (2S,4R)-4-[(7-chloro-1,8-naphthyridin-2-yl)oxy]-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](Oc2ccc3ccc(Cl)nc3n2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22ClN3O3/c1-11-9-13(10-22(11)17(23)25-18(2,3)4)24-15-8-6-12-5-7-14(19)20-16(12)21-15/h5-8,11,13H,9-10H2,1-4H3/t11-,13+/m0/s1 |
| InChIKey | QPIQWDGEVXJBQN-WCQYABFASA-N |
| XLogP | 4.06 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|