C18H30N4O5 — CID 154676025
tert-butyl (2S,4R)-4-[2-(2,2-dimethoxyethylamino)pyrimidin-5-yl]oxy-2-methylpyrrolidine-1-carboxylate (PubChem CID 154676025) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[2-(2,2-dimethoxyethylamino)pyrimidin-5-yl]oxy-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[2-(2,2-dimethoxyethylamino)pyrimidin-5-yl]oxy-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154676025 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | tert-butyl (2S,4R)-4-[2-(2,2-dimethoxyethylamino)pyrimidin-5-yl]oxy-2-methylpyrrolidine-1-carboxylate |
| SMILES | COC(CNc1ncc(O[C@@H]2C[C@H](C)N(C(=O)OC(C)(C)C)C2)cn1)OC |
| InChI | InChI=1S/C18H30N4O5/c1-12-7-13(11-22(12)17(23)27-18(2,3)4)26-14-8-19-16(20-9-14)21-10-15(24-5)25-6/h8-9,12-13,15H,7,10-11H2,1-6H3,(H,19,20,21)/t12-,13+/m0/s1 |
| InChIKey | AFNIZHXYPAHCQL-QWHCGFSZSA-N |
| XLogP | 2.28 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|