C11H17NO3 — CID 154676193
ethyl 2-but-3-enyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 154676193) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 2-but-3-enyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | ethyl 2-but-3-enyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154676193 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | ethyl 2-but-3-enyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=CCCC1(C(=O)OCC)CCC(=O)N1 |
| InChI | InChI=1S/C11H17NO3/c1-3-5-7-11(10(14)15-4-2)8-6-9(13)12-11/h3H,1,4-8H2,2H3,(H,12,13) |
| InChIKey | SCQUFNVMZDRTEP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|